About (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine
(R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine (PubChem CID 93243058) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine.
Molecular Properties
| Compound Name | (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine |
| PubChem CID | 93243058 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine |
| SMILES | N[C@H](c1ccccc1)c1ncon1 |
| InChI | InChI=1S/C9H9N3O/c10-8(9-11-6-13-12-9)7-4-2-1-3-5-7/h1-6,8H,10H2/t8-/m1/s1 |
| InChIKey | IYURJZDHJDSQMW-MRVPVSSYSA-N |
| XLogP | 1.12 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine?
The IUPAC name of (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine (CID 93243058) is (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine.
What is the SMILES notation for (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine?
The canonical SMILES for (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine is N[C@H](c1ccccc1)c1ncon1.
What is the InChIKey of (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine?
The InChIKey is IYURJZDHJDSQMW-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H9N3O/c10-8(9-11-6-13-12-9)7-4-2-1-3-5-7/h1-6,8H,10H2/t8-/m1/s1.
What are the key properties of (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine?
(R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine has a molecular weight of 175.19 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-1,2,4-oxadiazol-3-yl(phenyl)methanamine is sourced from PubChem (CID 93243058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).