C23H28N5OS+ — CID 9324593
2-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazole-3-thione (PubChem CID 9324593) has the molecular formula C23H28N5OS+ and a molecular weight of 422.58 g/mol. Its IUPAC name is 2-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9324593 |
| Molecular Formula | C23H28N5OS+ |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[[(2S)-2-(4-ethoxyphenyl)pyrrolidin-1-ium-1-yl]methyl]-4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(-c2cccnc2)nn(C[NH+]2CCC[C@H]2c2ccc(OCC)cc2)c1=S |
| InChI | InChI=1S/C23H27N5OS/c1-3-14-27-22(19-7-5-13-24-16-19)25-28(23(27)30)17-26-15-6-8-21(26)18-9-11-20(12-10-18)29-4-2/h3,5,7,9-13,16,21H,1,4,6,8,14-15,17H2,2H3/p+1/t21-/m0/s1 |
| InChIKey | DLFWCPQQBGLFPC-NRFANRHFSA-O |
| XLogP | 3.44 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|