About tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate
tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate (PubChem CID 932466) has the molecular formula C16H21N3O3S
and a molecular weight of 335.43 g/mol. Its IUPAC name is tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate |
| PubChem CID | 932466 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1nnc(SCc2ccccc2)o1 |
| InChI | InChI=1S/C16H21N3O3S/c1-16(2,3)22-14(20)17-10-9-13-18-19-15(21-13)23-11-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3,(H,17,20) |
| InChIKey | ZFUHEOHQUQSNDB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate (CID 932466) is tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate is CC(C)(C)OC(=O)NCCc1nnc(SCc2ccccc2)o1.
What is the InChIKey of tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate?
The InChIKey is ZFUHEOHQUQSNDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O3S/c1-16(2,3)22-14(20)17-10-9-13-18-19-15(21-13)23-11-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3,(H,17,20).
What are the key properties of tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate?
tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate has a molecular weight of 335.43 g/mol, XLogP of 3.43, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)ethyl]carbamate is sourced from PubChem (CID 932466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).