C11H15ClN2O — CID 93255469
(2R)-2-amino-N-(4-chlorophenyl)pentanamide (PubChem CID 93255469) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is (2R)-2-amino-N-(4-chlorophenyl)pentanamide.
| Compound Name | (2R)-2-amino-N-(4-chlorophenyl)pentanamide |
|---|---|
| PubChem CID | 93255469 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | (2R)-2-amino-N-(4-chlorophenyl)pentanamide |
| SMILES | CCC[C@@H](N)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H15ClN2O/c1-2-3-10(13)11(15)14-9-6-4-8(12)5-7-9/h4-7,10H,2-3,13H2,1H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | GNDFUKAKCCMWHB-SNVBAGLBSA-N |
| XLogP | 2.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |