C8H15N3O — CID 93257822
(2R)-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]propan-1-ol (PubChem CID 93257822) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is (2R)-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]propan-1-ol.
| Compound Name | (2R)-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 93257822 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | (2R)-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]propan-1-ol |
| SMILES | Cc1[nH]ncc1CN[C@H](C)CO |
| InChI | InChI=1S/C8H15N3O/c1-6(5-12)9-3-8-4-10-11-7(8)2/h4,6,9,12H,3,5H2,1-2H3,(H,10,11)/t6-/m1/s1 |
| InChIKey | RTEGGKHVTAVZQY-ZCFIWIBFSA-N |
| XLogP | 0.19 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |