C8H17N — CID 93261342
N-[[(1R,2S)-2-methylcyclopropyl]methyl]propan-1-amine (PubChem CID 93261342) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is N-[[(1R,2S)-2-methylcyclopropyl]methyl]propan-1-amine.
| Compound Name | N-[[(1R,2S)-2-methylcyclopropyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 93261342 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | N-[[(1R,2S)-2-methylcyclopropyl]methyl]propan-1-amine |
| SMILES | CCCNC[C@@H]1C[C@@H]1C |
| InChI | InChI=1S/C8H17N/c1-3-4-9-6-8-5-7(8)2/h7-9H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | CCNVZOFZCFBKQX-YUMQZZPRSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|