C22H27N3O3 — CID 9326771
4-[[(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl]amino]-N,N-diethylbenzamide (PubChem CID 9326771) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[[(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 9326771 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-[[(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N[C@H](C)C(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-5-25(6-2)22(28)18-9-13-19(14-10-18)23-15(3)21(27)24-20-11-7-17(8-12-20)16(4)26/h7-15,23H,5-6H2,1-4H3,(H,24,27)/t15-/m1/s1 |
| InChIKey | NCWTWPKEOWJZIT-OAHLLOKOSA-N |
| XLogP | 3.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |