C11H20N2O3 — CID 93268446
methyl 2-methyl-2-[[(2R)-piperidine-2-carbonyl]amino]propanoate (PubChem CID 93268446) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 2-methyl-2-[[(2R)-piperidine-2-carbonyl]amino]propanoate.
| Compound Name | methyl 2-methyl-2-[[(2R)-piperidine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 93268446 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | methyl 2-methyl-2-[[(2R)-piperidine-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)[C@H]1CCCCN1 |
| InChI | InChI=1S/C11H20N2O3/c1-11(2,10(15)16-3)13-9(14)8-6-4-5-7-12-8/h8,12H,4-7H2,1-3H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | AHPKBDARXROGSS-MRVPVSSYSA-N |
| XLogP | 0.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |