C18H22ClN3O3 — CID 9327303
4-chloro-N'-(cyclohexanecarbonyl)-3-(2-oxopyrrolidin-1-yl)benzohydrazide (PubChem CID 9327303) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is 4-chloro-N'-(cyclohexanecarbonyl)-3-(2-oxopyrrolidin-1-yl)benzohydrazide.
| Compound Name | 4-chloro-N'-(cyclohexanecarbonyl)-3-(2-oxopyrrolidin-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 9327303 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-chloro-N'-(cyclohexanecarbonyl)-3-(2-oxopyrrolidin-1-yl)benzohydrazide |
| SMILES | O=C(NNC(=O)C1CCCCC1)c1ccc(Cl)c(N2CCCC2=O)c1 |
| InChI | InChI=1S/C18H22ClN3O3/c19-14-9-8-13(11-15(14)22-10-4-7-16(22)23)18(25)21-20-17(24)12-5-2-1-3-6-12/h8-9,11-12H,1-7,10H2,(H,20,24)(H,21,25) |
| InChIKey | CUHHTAGSMLQCNW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|