About (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid
(2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid (PubChem CID 93280638) has the molecular formula C11H11F2NO2
and a molecular weight of 227.21 g/mol. Its IUPAC name is (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid.
Molecular Properties
| Compound Name | (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid |
| PubChem CID | 93280638 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid |
| SMILES | O=C(O)[C@H](NC1CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C11H11F2NO2/c12-7-2-1-3-8(13)9(7)10(11(15)16)14-6-4-5-6/h1-3,6,10,14H,4-5H2,(H,15,16)/t10-/m1/s1 |
| InChIKey | LLCVJLSDVSYPMV-SNVBAGLBSA-N |
| XLogP | 1.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid?
The IUPAC name of (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid (CID 93280638) is (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid.
What is the SMILES notation for (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid?
The canonical SMILES for (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid is O=C(O)[C@H](NC1CC1)c1c(F)cccc1F.
What is the InChIKey of (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid?
The InChIKey is LLCVJLSDVSYPMV-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H11F2NO2/c12-7-2-1-3-8(13)9(7)10(11(15)16)14-6-4-5-6/h1-3,6,10,14H,4-5H2,(H,15,16)/t10-/m1/s1.
What are the key properties of (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid?
(2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid has a molecular weight of 227.21 g/mol, XLogP of 1.84, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(cyclopropylamino)-2-(2,6-difluorophenyl)acetic acid is sourced from PubChem (CID 93280638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).