About 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide
2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide (PubChem CID 93282401) has the molecular formula C14H28N2O
and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide |
| PubChem CID | 93282401 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN[C@H]1CCCC[C@H]1C(C)(C)C |
| InChI | InChI=1S/C14H28N2O/c1-14(2,3)11-8-6-7-9-12(11)15-10-13(17)16(4)5/h11-12,15H,6-10H2,1-5H3/t11-,12+/m1/s1 |
| InChIKey | DDIOPXRIDRCGHI-NEPJUHHUSA-N |
| XLogP | 2.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide?
The IUPAC name of 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide (CID 93282401) is 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide is CN(C)C(=O)CN[C@H]1CCCC[C@H]1C(C)(C)C.
What is the InChIKey of 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide?
The InChIKey is DDIOPXRIDRCGHI-NEPJUHHUSA-N. The full InChI is InChI=1S/C14H28N2O/c1-14(2,3)11-8-6-7-9-12(11)15-10-13(17)16(4)5/h11-12,15H,6-10H2,1-5H3/t11-,12+/m1/s1.
What are the key properties of 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide?
2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide has a molecular weight of 240.39 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1S,2S)-2-tert-butylcyclohexyl]amino]-N,N-dimethylacetamide is sourced from PubChem (CID 93282401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).