C21H26N4O5 — CID 9328543
1-[[4-[[(3,5-dimethoxybenzoyl)amino]carbamoyl]phenyl]methyl]-3-propan-2-ylurea (PubChem CID 9328543) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-[[4-[[(3,5-dimethoxybenzoyl)amino]carbamoyl]phenyl]methyl]-3-propan-2-ylurea.
| Compound Name | 1-[[4-[[(3,5-dimethoxybenzoyl)amino]carbamoyl]phenyl]methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 9328543 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-[[4-[[(3,5-dimethoxybenzoyl)amino]carbamoyl]phenyl]methyl]-3-propan-2-ylurea |
| SMILES | COc1cc(OC)cc(C(=O)NNC(=O)c2ccc(CNC(=O)NC(C)C)cc2)c1 |
| InChI | InChI=1S/C21H26N4O5/c1-13(2)23-21(28)22-12-14-5-7-15(8-6-14)19(26)24-25-20(27)16-9-17(29-3)11-18(10-16)30-4/h5-11,13H,12H2,1-4H3,(H,24,26)(H,25,27)(H2,22,23,28) |
| InChIKey | CLSHNAQHLDFBMT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|