C12H18N2O8S — CID 93286347
4-[[(2R,3R,4R,5S,6S)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]amino]benzenesulfonamide (PubChem CID 93286347) has the molecular formula C12H18N2O8S and a molecular weight of 350.35 g/mol. Its IUPAC name is 4-[[(2R,3R,4R,5S,6S)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[(2R,3R,4R,5S,6S)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 93286347 |
| Molecular Formula | C12H18N2O8S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 4-[[(2R,3R,4R,5S,6S)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N[C@]2(O)O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C12H18N2O8S/c13-23(20,21)7-3-1-6(2-4-7)14-12(19)11(18)10(17)9(16)8(5-15)22-12/h1-4,8-11,14-19H,5H2,(H2,13,20,21)/t8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | GBKRMXPMCRWBET-VSSNEEPJSA-N |
| XLogP | -3.13 |
| TPSA | 182.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|