C25H27Cl2NO3 — CID 93295740
methyl (2S)-2-(4-tert-butylphenyl)-2-[(1R,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]acetate (PubChem CID 93295740) has the molecular formula C25H27Cl2NO3 and a molecular weight of 460.40 g/mol. Its IUPAC name is methyl (2S)-2-(4-tert-butylphenyl)-2-[(1R,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]acetate.
| Compound Name | methyl (2S)-2-(4-tert-butylphenyl)-2-[(1R,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 93295740 |
| Molecular Formula | C25H27Cl2NO3 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | methyl (2S)-2-(4-tert-butylphenyl)-2-[(1R,4S)-4-[(3,5-dichlorobenzoyl)amino]cyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)[C@H](c1ccc(C(C)(C)C)cc1)[C@H]1C=C[C@@H](NC(=O)c2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C25H27Cl2NO3/c1-25(2,3)18-8-5-15(6-9-18)22(24(30)31-4)16-7-10-21(13-16)28-23(29)17-11-19(26)14-20(27)12-17/h5-12,14,16,21-22H,13H2,1-4H3,(H,28,29)/t16-,21+,22+/m0/s1 |
| InChIKey | LUZRCSSGBZHGFH-KNXBSLHKSA-N |
| XLogP | 5.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|