C9H5Cl2NO — CID 93296296
(2S)-2-(2,6-dichlorophenyl)-3-oxopropanenitrile (PubChem CID 93296296) has the molecular formula C9H5Cl2NO and a molecular weight of 214.05 g/mol. Its IUPAC name is (2S)-2-(2,6-dichlorophenyl)-3-oxopropanenitrile.
| Compound Name | (2S)-2-(2,6-dichlorophenyl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 93296296 |
| Molecular Formula | C9H5Cl2NO |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | (2S)-2-(2,6-dichlorophenyl)-3-oxopropanenitrile |
| SMILES | N#C[C@@H](C=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H5Cl2NO/c10-7-2-1-3-8(11)9(7)6(4-12)5-13/h1-3,5-6H/t6-/m0/s1 |
| InChIKey | QHULXVIVIURTLB-LURJTMIESA-N |
| XLogP | 2.80 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|