C22H20ClN5O4 — CID 93296453
[(2S)-4-[6-(2-chlorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 93296453) has the molecular formula C22H20ClN5O4 and a molecular weight of 453.89 g/mol. Its IUPAC name is [(2S)-4-[6-(2-chlorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [(2S)-4-[6-(2-chlorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 93296453 |
| Molecular Formula | C22H20ClN5O4 |
| Molecular Weight | 453.89 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [(2S)-4-[6-(2-chlorophenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | C[C@H]1CN(c2cc(Oc3ccccc3Cl)ncn2)CCN1C(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20ClN5O4/c1-15-13-26(9-10-27(15)22(29)16-5-4-6-17(11-16)28(30)31)20-12-21(25-14-24-20)32-19-8-3-2-7-18(19)23/h2-8,11-12,14-15H,9-10,13H2,1H3/t15-/m0/s1 |
| InChIKey | PPKHUYITELXQKM-HNNXBMFYSA-N |
| XLogP | 4.18 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.89 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|