C23H27N3O2S — CID 9329899
N-(2,6-diethylphenyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide (PubChem CID 9329899) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,6-diethylphenyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 9329899 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-(2,6-diethylphenyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide |
| SMILES | CCCn1c(SCC(=O)Nc2c(CC)cccc2CC)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H27N3O2S/c1-4-14-26-22(28)18-12-7-8-13-19(18)24-23(26)29-15-20(27)25-21-16(5-2)10-9-11-17(21)6-3/h7-13H,4-6,14-15H2,1-3H3,(H,25,27) |
| InChIKey | PBONWMNMHSTNFB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |