C25H25ClN4O — CID 93300092
(2S)-2-[2-[(2-chlorophenyl)methyl]benzimidazol-1-yl]-N-(pyridin-2-ylmethyl)pentanamide (PubChem CID 93300092) has the molecular formula C25H25ClN4O and a molecular weight of 432.96 g/mol. Its IUPAC name is (2S)-2-[2-[(2-chlorophenyl)methyl]benzimidazol-1-yl]-N-(pyridin-2-ylmethyl)pentanamide.
| Compound Name | (2S)-2-[2-[(2-chlorophenyl)methyl]benzimidazol-1-yl]-N-(pyridin-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 93300092 |
| Molecular Formula | C25H25ClN4O |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (2S)-2-[2-[(2-chlorophenyl)methyl]benzimidazol-1-yl]-N-(pyridin-2-ylmethyl)pentanamide |
| SMILES | CCC[C@@H](C(=O)NCc1ccccn1)n1c(Cc2ccccc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C25H25ClN4O/c1-2-9-23(25(31)28-17-19-11-7-8-15-27-19)30-22-14-6-5-13-21(22)29-24(30)16-18-10-3-4-12-20(18)26/h3-8,10-15,23H,2,9,16-17H2,1H3,(H,28,31)/t23-/m0/s1 |
| InChIKey | MWWWDTSLUKQVLN-QHCPKHFHSA-N |
| XLogP | 5.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |