C20H21FN4O2S — CID 9330361
N-(4-fluorophenyl)-2-[4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-1-yl]acetamide (PubChem CID 9330361) has the molecular formula C20H21FN4O2S and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9330361 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(Cn2c(=S)oc3ccccc32)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN4O2S/c21-15-5-7-16(8-6-15)22-19(26)13-23-9-11-24(12-10-23)14-25-17-3-1-2-4-18(17)27-20(25)28/h1-8H,9-14H2,(H,22,26) |
| InChIKey | MJBCAMUXMDBRGC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|