C11H10ClN3O3S — CID 93306133
(2R)-2-[(5-chlorothiophene-2-carbonyl)amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 93306133) has the molecular formula C11H10ClN3O3S and a molecular weight of 299.74 g/mol. Its IUPAC name is (2R)-2-[(5-chlorothiophene-2-carbonyl)amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2R)-2-[(5-chlorothiophene-2-carbonyl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 93306133 |
| Molecular Formula | C11H10ClN3O3S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | (2R)-2-[(5-chlorothiophene-2-carbonyl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | O=C(N[C@H](Cc1cnc[nH]1)C(=O)O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H10ClN3O3S/c12-9-2-1-8(19-9)10(16)15-7(11(17)18)3-6-4-13-5-14-6/h1-2,4-5,7H,3H2,(H,13,14)(H,15,16)(H,17,18)/t7-/m1/s1 |
| InChIKey | DKONWLPWMJRHSX-SSDOTTSWSA-N |
| XLogP | 1.55 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |