C19H25N3O5S — CID 93306496
3,4-dimethoxy-N-[3-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-5-methyl-1,3-thiazol-2-ylidene]benzamide (PubChem CID 93306496) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[3-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-5-methyl-1,3-thiazol-2-ylidene]benzamide.
| Compound Name | 3,4-dimethoxy-N-[3-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-5-methyl-1,3-thiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 93306496 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3,4-dimethoxy-N-[3-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-5-methyl-1,3-thiazol-2-ylidene]benzamide |
| SMILES | COCCNC(=O)[C@@H](C)n1cc(C)s/c1=N\C(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H25N3O5S/c1-12-11-22(13(2)17(23)20-8-9-25-3)19(28-12)21-18(24)14-6-7-15(26-4)16(10-14)27-5/h6-7,10-11,13H,8-9H2,1-5H3,(H,20,23)/b21-19-/t13-/m1/s1 |
| InChIKey | YTQMXTJCYOHBAJ-IUXHBZJFSA-N |
| XLogP | 1.94 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|