C29H36N4O2 — CID 93308890
(3S)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-methyl-1-oxo-2-(3-phenylpropyl)-4H-pyrazino[1,2-a]benzimidazole-3-carboxamide (PubChem CID 93308890) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is (3S)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-methyl-1-oxo-2-(3-phenylpropyl)-4H-pyrazino[1,2-a]benzimidazole-3-carboxamide.
| Compound Name | (3S)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-methyl-1-oxo-2-(3-phenylpropyl)-4H-pyrazino[1,2-a]benzimidazole-3-carboxamide |
|---|---|
| PubChem CID | 93308890 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (3S)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-methyl-1-oxo-2-(3-phenylpropyl)-4H-pyrazino[1,2-a]benzimidazole-3-carboxamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@]1(C)Cn2c(nc3ccccc32)C(=O)N1CCCc1ccccc1 |
| InChI | InChI=1S/C29H36N4O2/c1-20-11-9-16-23(21(20)2)31-28(35)29(3)19-32-25-17-8-7-15-24(25)30-26(32)27(34)33(29)18-10-14-22-12-5-4-6-13-22/h4-8,12-13,15,17,20-21,23H,9-11,14,16,18-19H2,1-3H3,(H,31,35)/t20-,21-,23+,29+/m1/s1 |
| InChIKey | IYJIKKVTWAFUTL-BAUMMRMZSA-N |
| XLogP | 4.82 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |