C15H20N2O2 — CID 933122
methyl (4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxylate (PubChem CID 933122) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is methyl (4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxylate.
| Compound Name | methyl (4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 933122 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | methyl (4aS,9bR)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carboxylate |
| SMILES | COC(=O)N1c2ccc(C)cc2[C@@H]2CN(C)CC[C@@H]21 |
| InChI | InChI=1S/C15H20N2O2/c1-10-4-5-13-11(8-10)12-9-16(2)7-6-14(12)17(13)15(18)19-3/h4-5,8,12,14H,6-7,9H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | MAGXJTNGSMADNR-JSGCOSHPSA-N |
| XLogP | 2.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |