C22H21N3O2S — CID 9331236
N'-[3-[(2,4-dimethylphenyl)sulfanylmethyl]benzoyl]pyridine-2-carbohydrazide (PubChem CID 9331236) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is N'-[3-[(2,4-dimethylphenyl)sulfanylmethyl]benzoyl]pyridine-2-carbohydrazide.
| Compound Name | N'-[3-[(2,4-dimethylphenyl)sulfanylmethyl]benzoyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 9331236 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N'-[3-[(2,4-dimethylphenyl)sulfanylmethyl]benzoyl]pyridine-2-carbohydrazide |
| SMILES | Cc1ccc(SCc2cccc(C(=O)NNC(=O)c3ccccn3)c2)c(C)c1 |
| InChI | InChI=1S/C22H21N3O2S/c1-15-9-10-20(16(2)12-15)28-14-17-6-5-7-18(13-17)21(26)24-25-22(27)19-8-3-4-11-23-19/h3-13H,14H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | VXLTYIXYUSBMNQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|