C18H18F3N3O4 — CID 9331738
1-[[(2-ethyl-1-benzofuran-3-yl)methyl-methylamino]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione (PubChem CID 9331738) has the molecular formula C18H18F3N3O4 and a molecular weight of 397.35 g/mol. Its IUPAC name is 1-[[(2-ethyl-1-benzofuran-3-yl)methyl-methylamino]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[[(2-ethyl-1-benzofuran-3-yl)methyl-methylamino]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 9331738 |
| Molecular Formula | C18H18F3N3O4 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-[[(2-ethyl-1-benzofuran-3-yl)methyl-methylamino]methyl]-3-(2,2,2-trifluoroethyl)imidazolidine-2,4,5-trione |
| SMILES | CCc1oc2ccccc2c1CN(C)CN1C(=O)C(=O)N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C18H18F3N3O4/c1-3-13-12(11-6-4-5-7-14(11)28-13)8-22(2)10-24-16(26)15(25)23(17(24)27)9-18(19,20)21/h4-7H,3,8-10H2,1-2H3 |
| InChIKey | XGSSGHZEYIFYIN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|