C18H18Cl2N2O — CID 93321458
(3R)-4-benzyl-1-(2,4-dichlorophenyl)-3-methylpiperazin-2-one (PubChem CID 93321458) has the molecular formula C18H18Cl2N2O and a molecular weight of 349.26 g/mol. Its IUPAC name is (3R)-4-benzyl-1-(2,4-dichlorophenyl)-3-methylpiperazin-2-one.
| Compound Name | (3R)-4-benzyl-1-(2,4-dichlorophenyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 93321458 |
| Molecular Formula | C18H18Cl2N2O |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (3R)-4-benzyl-1-(2,4-dichlorophenyl)-3-methylpiperazin-2-one |
| SMILES | C[C@@H]1C(=O)N(c2ccc(Cl)cc2Cl)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C18H18Cl2N2O/c1-13-18(23)22(17-8-7-15(19)11-16(17)20)10-9-21(13)12-14-5-3-2-4-6-14/h2-8,11,13H,9-10,12H2,1H3/t13-/m1/s1 |
| InChIKey | ZCFSDJDRGCAFET-CYBMUJFWSA-N |
| XLogP | 4.23 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |