C19H26N6S2+2 — CID 9332223
1-(2,3-dimethylphenyl)-4-[[4-(thiophen-3-ylmethyl)piperazine-1,4-diium-1-yl]methyl]tetrazole-5-thione (PubChem CID 9332223) has the molecular formula C19H26N6S2+2 and a molecular weight of 402.59 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-4-[[4-(thiophen-3-ylmethyl)piperazine-1,4-diium-1-yl]methyl]tetrazole-5-thione.
| Compound Name | 1-(2,3-dimethylphenyl)-4-[[4-(thiophen-3-ylmethyl)piperazine-1,4-diium-1-yl]methyl]tetrazole-5-thione |
|---|---|
| PubChem CID | 9332223 |
| Molecular Formula | C19H26N6S2+2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-4-[[4-(thiophen-3-ylmethyl)piperazine-1,4-diium-1-yl]methyl]tetrazole-5-thione |
| SMILES | Cc1cccc(-n2nnn(C[NH+]3CC[NH+](Cc4ccsc4)CC3)c2=S)c1C |
| InChI | InChI=1S/C19H24N6S2/c1-15-4-3-5-18(16(15)2)25-19(26)24(20-21-25)14-23-9-7-22(8-10-23)12-17-6-11-27-13-17/h3-6,11,13H,7-10,12,14H2,1-2H3/p+2 |
| InChIKey | ZYNNCCKEMDWHLZ-UHFFFAOYSA-P |
| XLogP | 0.42 |
| TPSA | 44.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|