About (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one
(3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one (PubChem CID 93322523) has the molecular formula C24H22F2N2O
and a molecular weight of 392.45 g/mol. Its IUPAC name is (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one.
Molecular Properties
| Compound Name | (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one |
| PubChem CID | 93322523 |
| Molecular Formula | C24H22F2N2O |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one |
| SMILES | C[C@@H]1C(=O)N(c2ccccc2-c2ccccc2)CCN1Cc1c(F)cccc1F |
| InChI | InChI=1S/C24H22F2N2O/c1-17-24(29)28(15-14-27(17)16-20-21(25)11-7-12-22(20)26)23-13-6-5-10-19(23)18-8-3-2-4-9-18/h2-13,17H,14-16H2,1H3/t17-/m1/s1 |
| InChIKey | ZWCDWVMGWWUGOE-QGZVFWFLSA-N |
| XLogP | 4.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one?
The IUPAC name of (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one (CID 93322523) is (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one.
What is the SMILES notation for (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one?
The canonical SMILES for (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one is C[C@@H]1C(=O)N(c2ccccc2-c2ccccc2)CCN1Cc1c(F)cccc1F.
What is the InChIKey of (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one?
The InChIKey is ZWCDWVMGWWUGOE-QGZVFWFLSA-N. The full InChI is InChI=1S/C24H22F2N2O/c1-17-24(29)28(15-14-27(17)16-20-21(25)11-7-12-22(20)26)23-13-6-5-10-19(23)18-8-3-2-4-9-18/h2-13,17H,14-16H2,1H3/t17-/m1/s1.
What are the key properties of (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one?
(3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one has a molecular weight of 392.45 g/mol, XLogP of 4.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-[(2,6-difluorophenyl)methyl]-3-methyl-1-(2-phenylphenyl)piperazin-2-one is sourced from PubChem (CID 93322523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).