C24H28N2O3 — CID 93323839
(1R)-2-benzyl-1-(3,4,5-trimethoxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 93323839) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (1R)-2-benzyl-1-(3,4,5-trimethoxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | (1R)-2-benzyl-1-(3,4,5-trimethoxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 93323839 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (1R)-2-benzyl-1-(3,4,5-trimethoxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | COc1cc([C@@H]2c3cccn3CCCN2Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H28N2O3/c1-27-21-15-19(16-22(28-2)24(21)29-3)23-20-11-7-12-25(20)13-8-14-26(23)17-18-9-5-4-6-10-18/h4-7,9-12,15-16,23H,8,13-14,17H2,1-3H3/t23-/m1/s1 |
| InChIKey | BEZYCDUTJSTZOS-HSZRJFAPSA-N |
| XLogP | 4.51 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |