C20H26N6O4 — CID 93323873
N-[(2R)-butan-2-yl]-4-methoxy-2-[4-(2-nitrophenyl)piperazin-1-yl]pyrimidine-5-carboxamide (PubChem CID 93323873) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-4-methoxy-2-[4-(2-nitrophenyl)piperazin-1-yl]pyrimidine-5-carboxamide.
| Compound Name | N-[(2R)-butan-2-yl]-4-methoxy-2-[4-(2-nitrophenyl)piperazin-1-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 93323873 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-[(2R)-butan-2-yl]-4-methoxy-2-[4-(2-nitrophenyl)piperazin-1-yl]pyrimidine-5-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)c1cnc(N2CCN(c3ccccc3[N+](=O)[O-])CC2)nc1OC |
| InChI | InChI=1S/C20H26N6O4/c1-4-14(2)22-18(27)15-13-21-20(23-19(15)30-3)25-11-9-24(10-12-25)16-7-5-6-8-17(16)26(28)29/h5-8,13-14H,4,9-12H2,1-3H3,(H,22,27)/t14-/m1/s1 |
| InChIKey | CWGWXIQCGPUDGO-CQSZACIVSA-N |
| XLogP | 2.25 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|