C29H39N3O2 — CID 93324127
N-(cyclohexylmethyl)-2-[4-[[(2S)-2-phenylbutanoyl]amino]piperidin-1-yl]benzamide (PubChem CID 93324127) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[4-[[(2S)-2-phenylbutanoyl]amino]piperidin-1-yl]benzamide.
| Compound Name | N-(cyclohexylmethyl)-2-[4-[[(2S)-2-phenylbutanoyl]amino]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 93324127 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[4-[[(2S)-2-phenylbutanoyl]amino]piperidin-1-yl]benzamide |
| SMILES | CC[C@H](C(=O)NC1CCN(c2ccccc2C(=O)NCC2CCCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C29H39N3O2/c1-2-25(23-13-7-4-8-14-23)29(34)31-24-17-19-32(20-18-24)27-16-10-9-15-26(27)28(33)30-21-22-11-5-3-6-12-22/h4,7-10,13-16,22,24-25H,2-3,5-6,11-12,17-21H2,1H3,(H,30,33)(H,31,34)/t25-/m0/s1 |
| InChIKey | SCYYPHKMRAOXNP-VWLOTQADSA-N |
| XLogP | 5.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |