About N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine
N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine (PubChem CID 93329707) has the molecular formula C12H13F2N3
and a molecular weight of 237.25 g/mol. Its IUPAC name is N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine.
Molecular Properties
| Compound Name | N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine |
| PubChem CID | 93329707 |
| Molecular Formula | C12H13F2N3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine |
| SMILES | C[C@H](Nc1ccn(C)n1)c1c(F)cccc1F |
| InChI | InChI=1S/C12H13F2N3/c1-8(15-11-6-7-17(2)16-11)12-9(13)4-3-5-10(12)14/h3-8H,1-2H3,(H,15,16)/t8-/m0/s1 |
| InChIKey | BFFKKCNXDNWZFV-QMMMGPOBSA-N |
| XLogP | 2.87 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine?
The IUPAC name of N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine (CID 93329707) is N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine.
What is the SMILES notation for N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine?
The canonical SMILES for N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine is C[C@H](Nc1ccn(C)n1)c1c(F)cccc1F.
What is the InChIKey of N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine?
The InChIKey is BFFKKCNXDNWZFV-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H13F2N3/c1-8(15-11-6-7-17(2)16-11)12-9(13)4-3-5-10(12)14/h3-8H,1-2H3,(H,15,16)/t8-/m0/s1.
What are the key properties of N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine?
N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine has a molecular weight of 237.25 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-(2,6-difluorophenyl)ethyl]-1-methylpyrazol-3-amine is sourced from PubChem (CID 93329707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).