3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid

C11H18N2O3 — CID 93342073

IUPAC3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid
SMILESC=C[C@H]1CN(C(N)=O)CC[C@H]1CCC(=O)O
InChIInChI=1S/C11H18N2O3/c1-2-8-7-13(11(12)16)6-5-9(8)3-4-10(14)15/h2,8-9H,1,3-7H2,(H2,12,16)(H,14,15)/t8-,9+/m0/s1
InChIKeyAOZPKCUDUPOSOK-DTWKUNHWSA-N
MW226.28 g/mol
LogP1.05
Rot. Bonds4

About 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid

3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid (PubChem CID 93342073) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid
PubChem CID93342073
Molecular FormulaC11H18N2O3
Molecular Weight226.28 g/mol
Exact Mass226.13
IUPAC Name3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid
SMILESC=C[C@H]1CN(C(N)=O)CC[C@H]1CCC(=O)O
InChIInChI=1S/C11H18N2O3/c1-2-8-7-13(11(12)16)6-5-9(8)3-4-10(14)15/h2,8-9H,1,3-7H2,(H2,12,16)(H,14,15)/t8-,9+/m0/s1
InChIKeyAOZPKCUDUPOSOK-DTWKUNHWSA-N
XLogP1.05
TPSA83.63 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.28
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid?
The IUPAC name of 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid (CID 93342073) is 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid.
What is the SMILES notation for 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid?
The canonical SMILES for 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid is C=C[C@H]1CN(C(N)=O)CC[C@H]1CCC(=O)O.
What is the InChIKey of 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid?
The InChIKey is AOZPKCUDUPOSOK-DTWKUNHWSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-2-8-7-13(11(12)16)6-5-9(8)3-4-10(14)15/h2,8-9H,1,3-7H2,(H2,12,16)(H,14,15)/t8-,9+/m0/s1.
What are the key properties of 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid?
3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid has a molecular weight of 226.28 g/mol, XLogP of 1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4R)-1-carbamoyl-3-ethenylpiperidin-4-yl]propanoic acid is sourced from PubChem (CID 93342073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).