C21H25N3O4S — CID 9334496
[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 9334496) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 9334496 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [2-oxo-2-(3-propan-2-yloxypropylamino)ethyl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)OCC(=O)NCCCOC(C)C)cc12 |
| InChI | InChI=1S/C21H25N3O4S/c1-14(2)27-11-7-10-22-19(25)13-28-21(26)18-12-17-15(3)23-24(20(17)29-18)16-8-5-4-6-9-16/h4-6,8-9,12,14H,7,10-11,13H2,1-3H3,(H,22,25) |
| InChIKey | VRZIRERMEXLYOC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|