C17H19ClN2O2 — CID 9335614
2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-(4-methoxyphenyl)acetamide (PubChem CID 9335614) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9335614 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN[C@@H](C)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-12(13-3-5-14(18)6-4-13)19-11-17(21)20-15-7-9-16(22-2)10-8-15/h3-10,12,19H,11H2,1-2H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | CRHNVFALHYIWKB-LBPRGKRZSA-N |
| XLogP | 3.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |