About 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol
2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol (PubChem CID 933625) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol.
Molecular Properties
| Compound Name | 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol |
| PubChem CID | 933625 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol |
| SMILES | CCCN(CCO)CC1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C15H27NO/c1-4-7-16(8-9-17)11-12-5-6-13-10-14(12)15(13,2)3/h5,13-14,17H,4,6-11H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | MPKIIGPFHJAQPX-KBPBESRZSA-N |
| XLogP | 2.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol?
The IUPAC name of 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol (CID 933625) is 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol.
What is the SMILES notation for 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol?
The canonical SMILES for 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol is CCCN(CCO)CC1=CC[C@H]2C[C@@H]1C2(C)C.
What is the InChIKey of 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol?
The InChIKey is MPKIIGPFHJAQPX-KBPBESRZSA-N. The full InChI is InChI=1S/C15H27NO/c1-4-7-16(8-9-17)11-12-5-6-13-10-14(12)15(13,2)3/h5,13-14,17H,4,6-11H2,1-3H3/t13-,14-/m0/s1.
What are the key properties of 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol?
2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol has a molecular weight of 237.39 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-propylamino]ethanol is sourced from PubChem (CID 933625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).