C20H24N2O5S — CID 9336603
ethyl 4-[[4-(benzylamino)-4-oxobutyl]sulfamoyl]benzoate (PubChem CID 9336603) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is ethyl 4-[[4-(benzylamino)-4-oxobutyl]sulfamoyl]benzoate.
| Compound Name | ethyl 4-[[4-(benzylamino)-4-oxobutyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 9336603 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | ethyl 4-[[4-(benzylamino)-4-oxobutyl]sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NCCCC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-2-27-20(24)17-10-12-18(13-11-17)28(25,26)22-14-6-9-19(23)21-15-16-7-4-3-5-8-16/h3-5,7-8,10-13,22H,2,6,9,14-15H2,1H3,(H,21,23) |
| InChIKey | HGEAOOMXAQJPOG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|