C12H10ClNO5 — CID 93366698
5-[[(1R,2S)-2-carboxycyclopropanecarbonyl]amino]-2-chlorobenzoic acid (PubChem CID 93366698) has the molecular formula C12H10ClNO5 and a molecular weight of 283.67 g/mol. Its IUPAC name is 5-[[(1R,2S)-2-carboxycyclopropanecarbonyl]amino]-2-chlorobenzoic acid.
| Compound Name | 5-[[(1R,2S)-2-carboxycyclopropanecarbonyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 93366698 |
| Molecular Formula | C12H10ClNO5 |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 5-[[(1R,2S)-2-carboxycyclopropanecarbonyl]amino]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(NC(=O)[C@@H]2C[C@@H]2C(=O)O)ccc1Cl |
| InChI | InChI=1S/C12H10ClNO5/c13-9-2-1-5(3-8(9)12(18)19)14-10(15)6-4-7(6)11(16)17/h1-3,6-7H,4H2,(H,14,15)(H,16,17)(H,18,19)/t6-,7+/m1/s1 |
| InChIKey | VTGDBVIYOYBAAJ-RQJHMYQMSA-N |
| XLogP | 1.70 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |