C17H15N3O3S2 — CID 9337216
2-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-(2-nitrophenyl)sulfanyl-1,3,4-oxadiazole (PubChem CID 9337216) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-(2-nitrophenyl)sulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-(2-nitrophenyl)sulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 9337216 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 2-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-5-(2-nitrophenyl)sulfanyl-1,3,4-oxadiazole |
| SMILES | C[C@@H]1CCc2sc(-c3nnc(Sc4ccccc4[N+](=O)[O-])o3)cc2C1 |
| InChI | InChI=1S/C17H15N3O3S2/c1-10-6-7-13-11(8-10)9-15(24-13)16-18-19-17(23-16)25-14-5-3-2-4-12(14)20(21)22/h2-5,9-10H,6-8H2,1H3/t10-/m1/s1 |
| InChIKey | SGFUEXDSOJZECJ-SNVBAGLBSA-N |
| XLogP | 4.98 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|