C12H21N3O2 — CID 93372174
(2R)-N-(2-amino-2-oxoethyl)-N-cyclopentylpyrrolidine-2-carboxamide (PubChem CID 93372174) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is (2R)-N-(2-amino-2-oxoethyl)-N-cyclopentylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(2-amino-2-oxoethyl)-N-cyclopentylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 93372174 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | (2R)-N-(2-amino-2-oxoethyl)-N-cyclopentylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)CN(C(=O)[C@H]1CCCN1)C1CCCC1 |
| InChI | InChI=1S/C12H21N3O2/c13-11(16)8-15(9-4-1-2-5-9)12(17)10-6-3-7-14-10/h9-10,14H,1-8H2,(H2,13,16)/t10-/m1/s1 |
| InChIKey | OYMMGKFMNGDMBI-SNVBAGLBSA-N |
| XLogP | -0.01 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |