About 2,6-dihydroxybenzoic acid
2,6-dihydroxybenzoic acid (PubChem CID 9338) has the molecular formula C7H6O4
and a molecular weight of 154.12 g/mol. Its IUPAC name is 2,6-dihydroxybenzoic acid.
Molecular Properties
| Compound Name | 2,6-dihydroxybenzoic acid |
| PubChem CID | 9338 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 2,6-dihydroxybenzoic acid |
| SMILES | O=C(O)c1c(O)cccc1O |
| InChI | InChI=1S/C7H6O4/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,8-9H,(H,10,11) |
| InChIKey | AKEUNCKRJATALU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dihydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dihydroxybenzoic acid?
The IUPAC name of 2,6-dihydroxybenzoic acid (CID 9338) is 2,6-dihydroxybenzoic acid.
What is the SMILES notation for 2,6-dihydroxybenzoic acid?
The canonical SMILES for 2,6-dihydroxybenzoic acid is O=C(O)c1c(O)cccc1O.
What is the InChIKey of 2,6-dihydroxybenzoic acid?
The InChIKey is AKEUNCKRJATALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,8-9H,(H,10,11).
What are the key properties of 2,6-dihydroxybenzoic acid?
2,6-dihydroxybenzoic acid has a molecular weight of 154.12 g/mol, XLogP of 0.80, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dihydroxybenzoic acid is sourced from PubChem (CID 9338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).