C12H23NO — CID 93383696
trans-(1R,2R)-2-(cyclopentylamino)cycloheptan-1-ol (PubChem CID 93383696) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is trans-(1R,2R)-2-(cyclopentylamino)cycloheptan-1-ol.
| Compound Name | trans-(1R,2R)-2-(cyclopentylamino)cycloheptan-1-ol |
|---|---|
| PubChem CID | 93383696 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | trans-(1R,2R)-2-(cyclopentylamino)cycloheptan-1-ol |
| SMILES | O[C@@H]1CCCCC[C@H]1NC1CCCC1 |
| InChI | InChI=1S/C12H23NO/c14-12-9-3-1-2-8-11(12)13-10-6-4-5-7-10/h10-14H,1-9H2/t11-,12-/m1/s1 |
| InChIKey | VEWDXEYZZHXEET-VXGBXAGGSA-N |
| XLogP | 2.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |