C12H17NO2 — CID 93384487
(3S,4R)-4-(2,5-dimethylanilino)oxolan-3-ol (PubChem CID 93384487) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (3S,4R)-4-(2,5-dimethylanilino)oxolan-3-ol.
| Compound Name | (3S,4R)-4-(2,5-dimethylanilino)oxolan-3-ol |
|---|---|
| PubChem CID | 93384487 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (3S,4R)-4-(2,5-dimethylanilino)oxolan-3-ol |
| SMILES | Cc1ccc(C)c(N[C@@H]2COC[C@H]2O)c1 |
| InChI | InChI=1S/C12H17NO2/c1-8-3-4-9(2)10(5-8)13-11-6-15-7-12(11)14/h3-5,11-14H,6-7H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | UWYQUGMZWYLPFU-VXGBXAGGSA-N |
| XLogP | 1.48 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |