C21H21F3N4S — CID 9339282
12-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 9339282) has the molecular formula C21H21F3N4S and a molecular weight of 418.49 g/mol. Its IUPAC name is 12-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 9339282 |
| Molecular Formula | C21H21F3N4S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 12-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | FC(F)(F)c1cccc(CN2CCN(c3ncnc4sc5c(c34)CCC5)CC2)c1 |
| InChI | InChI=1S/C21H21F3N4S/c22-21(23,24)15-4-1-3-14(11-15)12-27-7-9-28(10-8-27)19-18-16-5-2-6-17(16)29-20(18)26-13-25-19/h1,3-4,11,13H,2,5-10,12H2 |
| InChIKey | BBLIMOBJCIHGMR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |