C15H18N3O3+ — CID 9340142
N-[(1S)-1-(4-methoxyphenyl)propyl]-3-nitropyridin-1-ium-2-amine (PubChem CID 9340142) has the molecular formula C15H18N3O3+ and a molecular weight of 288.33 g/mol. Its IUPAC name is N-[(1S)-1-(4-methoxyphenyl)propyl]-3-nitropyridin-1-ium-2-amine.
| Compound Name | N-[(1S)-1-(4-methoxyphenyl)propyl]-3-nitropyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9340142 |
| Molecular Formula | C15H18N3O3+ |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-[(1S)-1-(4-methoxyphenyl)propyl]-3-nitropyridin-1-ium-2-amine |
| SMILES | CC[C@H](Nc1[nH+]cccc1[N+](=O)[O-])c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H17N3O3/c1-3-13(11-6-8-12(21-2)9-7-11)17-15-14(18(19)20)5-4-10-16-15/h4-10,13H,3H2,1-2H3,(H,16,17)/p+1/t13-/m0/s1 |
| InChIKey | SWHBRTAMSLPHSS-ZDUSSCGKSA-O |
| XLogP | 2.98 |
| TPSA | 78.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|