C16H14BrFN2O3 — CID 9340444
N'-[(2R)-2-(4-bromophenoxy)propanoyl]-4-fluorobenzohydrazide (PubChem CID 9340444) has the molecular formula C16H14BrFN2O3 and a molecular weight of 381.20 g/mol. Its IUPAC name is N'-[(2R)-2-(4-bromophenoxy)propanoyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[(2R)-2-(4-bromophenoxy)propanoyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 9340444 |
| Molecular Formula | C16H14BrFN2O3 |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | N'-[(2R)-2-(4-bromophenoxy)propanoyl]-4-fluorobenzohydrazide |
| SMILES | C[C@@H](Oc1ccc(Br)cc1)C(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14BrFN2O3/c1-10(23-14-8-4-12(17)5-9-14)15(21)19-20-16(22)11-2-6-13(18)7-3-11/h2-10H,1H3,(H,19,21)(H,20,22)/t10-/m1/s1 |
| InChIKey | YXSIXXJAIKOSMT-SNVBAGLBSA-N |
| XLogP | 2.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|