C19H22ClN5O2S — CID 9340566
(2S)-1-[2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]piperidine-2-carboxamide (PubChem CID 9340566) has the molecular formula C19H22ClN5O2S and a molecular weight of 419.94 g/mol. Its IUPAC name is (2S)-1-[2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-[2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 9340566 |
| Molecular Formula | C19H22ClN5O2S |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (2S)-1-[2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]piperidine-2-carboxamide |
| SMILES | C=CCn1c(SCC(=O)N2CCCC[C@H]2C(N)=O)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClN5O2S/c1-2-10-25-18(13-6-8-14(20)9-7-13)22-23-19(25)28-12-16(26)24-11-4-3-5-15(24)17(21)27/h2,6-9,15H,1,3-5,10-12H2,(H2,21,27)/t15-/m0/s1 |
| InChIKey | MWAIASXQNUKTAG-HNNXBMFYSA-N |
| XLogP | 2.74 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|