C23H30N4O2S — CID 9341264
1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 9341264) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 9341264 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | C=CCn1c(SCC(=O)N2CC[C@@H]3CCCC[C@H]3C2)nnc1-c1ccccc1OC |
| InChI | InChI=1S/C23H30N4O2S/c1-3-13-27-22(19-10-6-7-11-20(19)29-2)24-25-23(27)30-16-21(28)26-14-12-17-8-4-5-9-18(17)15-26/h3,6-7,10-11,17-18H,1,4-5,8-9,12-16H2,2H3/t17-,18-/m0/s1 |
| InChIKey | XGEDAUQKEJQGOG-ROUUACIJSA-N |
| XLogP | 4.27 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|