C15H15BrN2O3S — CID 9341633
2-bromo-N-(3-methylphenyl)-5-(methylsulfamoyl)benzamide (PubChem CID 9341633) has the molecular formula C15H15BrN2O3S and a molecular weight of 383.27 g/mol. Its IUPAC name is 2-bromo-N-(3-methylphenyl)-5-(methylsulfamoyl)benzamide.
| Compound Name | 2-bromo-N-(3-methylphenyl)-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9341633 |
| Molecular Formula | C15H15BrN2O3S |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2-bromo-N-(3-methylphenyl)-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(Br)c(C(=O)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C15H15BrN2O3S/c1-10-4-3-5-11(8-10)18-15(19)13-9-12(6-7-14(13)16)22(20,21)17-2/h3-9,17H,1-2H3,(H,18,19) |
| InChIKey | IPBSAKMUNMWCKU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |