About methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate
methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate (PubChem CID 93416526) has the molecular formula C9H16F3NO2
and a molecular weight of 227.23 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate.
Molecular Properties
| Compound Name | methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate |
| PubChem CID | 93416526 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2/c1-6(2)4-7(8(14)15-3)13-5-9(10,11)12/h6-7,13H,4-5H2,1-3H3/t7-/m0/s1 |
| InChIKey | FNUGEGHUHDGHJS-ZETCQYMHSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate?
The IUPAC name of methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate (CID 93416526) is methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate.
What is the SMILES notation for methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate?
The canonical SMILES for methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate is COC(=O)[C@H](CC(C)C)NCC(F)(F)F.
What is the InChIKey of methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate?
The InChIKey is FNUGEGHUHDGHJS-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H16F3NO2/c1-6(2)4-7(8(14)15-3)13-5-9(10,11)12/h6-7,13H,4-5H2,1-3H3/t7-/m0/s1.
What are the key properties of methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate?
methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate has a molecular weight of 227.23 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-4-methyl-2-(2,2,2-trifluoroethylamino)pentanoate is sourced from PubChem (CID 93416526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).